C6H14NO8P — CID 167491505
[(2R,3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxyphosphonamidic acid (PubChem CID 167491505) has the molecular formula C6H14NO8P and a molecular weight of 259.15 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxyphosphonamidic acid.
| Compound Name | [(2R,3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxyphosphonamidic acid |
|---|---|
| PubChem CID | 167491505 |
| Molecular Formula | C6H14NO8P |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | [(2R,3S,4S,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxyphosphonamidic acid |
| SMILES | NP(=O)(O)OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14NO8P/c7-16(12,13)14-1-2-3(8)4(9)5(10)6(11)15-2/h2-6,8-11H,1H2,(H3,7,12,13)/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | HNNILXPLBPZXKM-QTVWNMPRSA-N |
| XLogP | -3.14 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|