C7H15O8P — CID 89181885
methyl-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]phosphinic acid (PubChem CID 89181885) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is methyl-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]phosphinic acid.
| Compound Name | methyl-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 89181885 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | methyl-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]phosphinic acid |
| SMILES | CP(=O)(O)OCC1O[C@H](O)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H15O8P/c1-16(12,13)14-2-3-4(8)5(9)6(10)7(11)15-3/h3-11H,2H2,1H3,(H,12,13)/t3?,4-,5+,6?,7+/m1/s1 |
| InChIKey | UQJDGYJOWJSSON-UACUTCHMSA-N |
| XLogP | -2.38 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|