C11H23O7P — CID 59119173
[(2R,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methoxy-methylphosphinic acid (PubChem CID 59119173) has the molecular formula C11H23O7P and a molecular weight of 298.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 59119173 |
| Molecular Formula | C11H23O7P |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methoxy-methylphosphinic acid |
| SMILES | CC(C)(C)[C@@H]1O[C@H](COP(C)(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H23O7P/c1-11(2,3)10-9(14)8(13)7(12)6(18-10)5-17-19(4,15)16/h6-10,12-14H,5H2,1-4H3,(H,15,16)/t6-,7-,8+,9-,10-/m1/s1 |
| InChIKey | CUIOBNHPWBLIJI-HOTMZDKISA-N |
| XLogP | -0.29 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|