C8H17O6P — CID 158256198
[(2R,3S,4S,5S)-4-hydroxy-3-methoxy-5-methyloxolan-2-yl]methoxy-methylphosphinic acid (PubChem CID 158256198) has the molecular formula C8H17O6P and a molecular weight of 240.19 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-4-hydroxy-3-methoxy-5-methyloxolan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,4S,5S)-4-hydroxy-3-methoxy-5-methyloxolan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 158256198 |
| Molecular Formula | C8H17O6P |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | [(2R,3S,4S,5S)-4-hydroxy-3-methoxy-5-methyloxolan-2-yl]methoxy-methylphosphinic acid |
| SMILES | CO[C@H]1[C@@H](O)[C@H](C)O[C@@H]1COP(C)(=O)O |
| InChI | InChI=1S/C8H17O6P/c1-5-7(9)8(12-2)6(14-5)4-13-15(3,10)11/h5-9H,4H2,1-3H3,(H,10,11)/t5-,6+,7-,8+/m0/s1 |
| InChIKey | GHHWGBXQYUFHFM-FKSUSPILSA-N |
| XLogP | -0.02 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|