C11H22O4 — CID 70862657
(3S,4R,5R,6S)-2-tert-butyl-6-ethyloxane-3,4,5-triol (PubChem CID 70862657) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is (3S,4R,5R,6S)-2-tert-butyl-6-ethyloxane-3,4,5-triol.
| Compound Name | (3S,4R,5R,6S)-2-tert-butyl-6-ethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 70862657 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (3S,4R,5R,6S)-2-tert-butyl-6-ethyloxane-3,4,5-triol |
| SMILES | CC[C@@H]1OC(C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H22O4/c1-5-6-7(12)8(13)9(14)10(15-6)11(2,3)4/h6-10,12-14H,5H2,1-4H3/t6-,7-,8+,9-,10?/m0/s1 |
| InChIKey | UDDSJSWXNOIWBV-YZUYTKQYSA-N |
| XLogP | 0.29 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |