C10H19FO4 — CID 20758632
2-tert-butyl-6-(fluoromethyl)oxane-3,4,5-triol (PubChem CID 20758632) has the molecular formula C10H19FO4 and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-tert-butyl-6-(fluoromethyl)oxane-3,4,5-triol.
| Compound Name | 2-tert-butyl-6-(fluoromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 20758632 |
| Molecular Formula | C10H19FO4 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-tert-butyl-6-(fluoromethyl)oxane-3,4,5-triol |
| SMILES | CC(C)(C)C1OC(CF)C(O)C(O)C1O |
| InChI | InChI=1S/C10H19FO4/c1-10(2,3)9-8(14)7(13)6(12)5(4-11)15-9/h5-9,12-14H,4H2,1-3H3 |
| InChIKey | XXYBHWCDWLYSFE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |