C12H22O5S — CID 59762518
S-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl] ethanethioate (PubChem CID 59762518) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is S-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 59762518 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | S-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1OC(C(C)(C)C)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O5S/c1-6(13)18-5-7-8(14)9(15)10(16)11(17-7)12(2,3)4/h7-11,14-16H,5H2,1-4H3/t7?,8-,9-,10?,11?/m0/s1 |
| InChIKey | VYRJWZZYKDHTNP-BJYFRKOGSA-N |
| XLogP | 0.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|