C9H16O6S — CID 53304607
S-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] ethanethioate (PubChem CID 53304607) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is S-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 53304607 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | S-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] ethanethioate |
| SMILES | CO[C@H]1O[C@H](CSC(C)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O6S/c1-4(10)16-3-5-6(11)7(12)8(13)9(14-2)15-5/h5-9,11-13H,3H2,1-2H3/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | PQCAVUJMPSIKQS-ZEBDFXRSSA-N |
| XLogP | -1.28 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|