C7H14O6 — CID 101247773
(2R,3R,4S,5R,6R)-2-(hydroxy(113C)methyl)-6-methoxy(2,3-13C2)oxane-3,4,5-triol (PubChem CID 101247773) has the molecular formula C7H14O6 and a molecular weight of 197.16 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxy(113C)methyl)-6-methoxy(2,3-13C2)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxy(113C)methyl)-6-methoxy(2,3-13C2)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101247773 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxy(113C)methyl)-6-methoxy(2,3-13C2)oxane-3,4,5-triol |
| SMILES | CO[C@@H]1O[13C@H]([13CH2]O)[13C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4+,5+,6-,7-/m1/s1/i2+1,3+1,4+1 |
| InChIKey | HOVAGTYPODGVJG-PYSFKNHRSA-N |
| XLogP | -2.57 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |