C14H28O12 — CID 160867169
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol (PubChem CID 160867169) has the molecular formula C14H28O12 and a molecular weight of 388.37 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 160867169 |
| Molecular Formula | C14H28O12 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/2C7H14O6/c2*1-12-7-6(11)5(10)4(9)3(2-8)13-7/h2*3-11H,2H2,1H3/t3-,4+,5+,6-,7-;3-,4-,5+,6-,7-/m11/s1 |
| InChIKey | SLGQSQKJNBMROW-FYEIZITMSA-N |
| XLogP | -5.13 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -5.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |