C6H11FO4S — CID 59184393
2-((18F)fluoromethyl)-6-sulfanyloxane-3,4,5-triol (PubChem CID 59184393) has the molecular formula C6H11FO4S and a molecular weight of 197.22 g/mol. Its IUPAC name is 2-((18F)fluoromethyl)-6-sulfanyloxane-3,4,5-triol.
| Compound Name | 2-((18F)fluoromethyl)-6-sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 59184393 |
| Molecular Formula | C6H11FO4S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-((18F)fluoromethyl)-6-sulfanyloxane-3,4,5-triol |
| SMILES | OC1C(S)OC(C[18F])C(O)C1O |
| InChI | InChI=1S/C6H11FO4S/c7-1-2-3(8)4(9)5(10)6(12)11-2/h2-6,8-10,12H,1H2/i7-1 |
| InChIKey | QWBJXGCHRDOEED-JZRMKITLSA-N |
| XLogP | -1.31 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|