C6H12NaO5S — CID 131882251
alpha-D-Glucopyranose, 1-thio-, sodium salt (1:1) (PubChem CID 131882251) has the molecular formula C6H12NaO5S and a molecular weight of 219.21 g/mol.
| Compound Name | alpha-D-Glucopyranose, 1-thio-, sodium salt (1:1) |
|---|---|
| PubChem CID | 131882251 |
| Molecular Formula | C6H12NaO5S |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | — |
| SMILES | OC[C@H]1O[C@H](S)[C@H](O)[C@@H](O)[C@@H]1O.[Na] |
| InChI | InChI=1S/C6H12O5S.Na/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10,12H,1H2;/t2-,3-,4+,5-,6-;/m1./s1 |
| InChIKey | BHHKGFGJKMSQDZ-WYRLRVFGSA-N |
| XLogP | -2.66 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|