C6H12AuO5S — CID 88799890
gold;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol (PubChem CID 88799890) has the molecular formula C6H12AuO5S and a molecular weight of 393.19 g/mol. Its IUPAC name is gold;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol.
| Compound Name | gold;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 88799890 |
| Molecular Formula | C6H12AuO5S |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | gold;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](S)[C@H](O)[C@@H](O)[C@@H]1O.[Au] |
| InChI | InChI=1S/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10,12H,1H2;/t2-,3-,4+,5-,6+;/m1./s1 |
| InChIKey | RZFZJRIQKXLYCP-WNFIKIDCSA-N |
| XLogP | -2.29 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|