C6H12O5S — CID 87274614
(2S,3S,4R,5S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol (PubChem CID 87274614) has the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 87274614 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (2S,3S,4R,5S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol |
| SMILES | OC[C@@H]1OC(S)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O5S/c7-1-2-3(8)4(9)5(10)6(12)11-2/h2-10,12H,1H2/t2-,3+,4+,5-,6?/m0/s1 |
| InChIKey | JUSMHIGDXPKSID-DHVFOXMCSA-N |
| XLogP | -2.28 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|