C7H14O6 — CID 4670797
2,6-bis(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 4670797) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2,6-bis(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 4670797 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2,6-bis(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C7H14O6/c8-1-3-5(10)7(12)6(11)4(2-9)13-3/h3-12H,1-2H2 |
| InChIKey | UBWUHZBLCOLWME-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |