C6H12O6 — CID 11492034
(3R,4S,5S,6R)-6-((15O)oxidanylmethyl)oxane-2,3,4,5-tetrol (PubChem CID 11492034) has the molecular formula C6H12O6 and a molecular weight of 179.16 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-((15O)oxidanylmethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-6-((15O)oxidanylmethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 11492034 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 179.16 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (3R,4S,5S,6R)-6-((15O)oxidanylmethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC1O[C@H](C[15OH])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1/i7-1 |
| InChIKey | WQZGKKKJIJFFOK-MOOMFTQBSA-N |
| XLogP | -3.22 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.16 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |