C6H14O7 — CID 174454865
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;hydrate (PubChem CID 174454865) has the molecular formula C6H14O7 and a molecular weight of 198.17 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;hydrate.
| Compound Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;hydrate |
|---|---|
| PubChem CID | 174454865 |
| Molecular Formula | C6H14O7 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;hydrate |
| SMILES | O.OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O6.H2O/c7-1-2-3(8)4(9)5(10)6(11)12-2;/h2-11H,1H2;1H2/t2-,3+,4+,5-,6-;/m1./s1 |
| InChIKey | OSNSWKAZFASRNG-ZFWXJGAOSA-N |
| XLogP | -4.05 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |