C6H15BiO6 — CID 173193774
bismuthane;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 173193774) has the molecular formula C6H15BiO6 and a molecular weight of 392.16 g/mol. Its IUPAC name is bismuthane;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | bismuthane;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 173193774 |
| Molecular Formula | C6H15BiO6 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | bismuthane;(2S,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O.[BiH3] |
| InChI | InChI=1S/C6H12O6.Bi.3H/c7-1-2-3(8)4(9)5(10)6(11)12-2;;;;/h2-11H,1H2;;;;/t2-,3-,4+,5-,6+;;;;/m1..../s1 |
| InChIKey | GFLUTZXOGAOKSP-QNXMXSBRSA-N |
| XLogP | -4.41 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |