C6H15NO6 — CID 70501516
azane;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 70501516) has the molecular formula C6H15NO6 and a molecular weight of 197.19 g/mol. Its IUPAC name is azane;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | azane;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 70501516 |
| Molecular Formula | C6H15NO6 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | azane;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | N.OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6.H3N/c7-1-2-3(8)4(9)5(10)6(11)12-2;/h2-11H,1H2;1H3/t2-,3-,4+,5-,6?;/m1./s1 |
| InChIKey | CGQIWLVZBLNPSQ-BMZZJELJSA-N |
| XLogP | -3.06 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |