C6H13NO4S — CID 130967285
(2R,3S,4R,5R)-5-amino-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol (PubChem CID 130967285) has the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-amino-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-amino-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 130967285 |
| Molecular Formula | C6H13NO4S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (2R,3S,4R,5R)-5-amino-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol |
| SMILES | N[C@H]1C(S)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4S/c7-3-5(10)4(9)2(1-8)11-6(3)12/h2-6,8-10,12H,1,7H2/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | WTUCFWNQWAFNMH-IVMDWMLBSA-N |
| XLogP | -2.32 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|