C6H12O3S — CID 130303244
2-ethyl-5-sulfanyloxolane-3,4-diol (PubChem CID 130303244) has the molecular formula C6H12O3S and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-ethyl-5-sulfanyloxolane-3,4-diol.
| Compound Name | 2-ethyl-5-sulfanyloxolane-3,4-diol |
|---|---|
| PubChem CID | 130303244 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-ethyl-5-sulfanyloxolane-3,4-diol |
| SMILES | CCC1OC(S)C(O)C1O |
| InChI | InChI=1S/C6H12O3S/c1-2-3-4(7)5(8)6(10)9-3/h3-8,10H,2H2,1H3 |
| InChIKey | KBPOHBIVEBIDJG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|