C5H11O9P — CID 171123123
hydroxy [(2R,3S,4R,5S)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 171123123) has the molecular formula C5H11O9P and a molecular weight of 246.11 g/mol. Its IUPAC name is hydroxy [(2R,3S,4R,5S)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | hydroxy [(2R,3S,4R,5S)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 171123123 |
| Molecular Formula | C5H11O9P |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | hydroxy [(2R,3S,4R,5S)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=P(O)(OO)OC[C@H]1O[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H11O9P/c6-3-2(13-5(8)4(3)7)1-12-15(10,11)14-9/h2-9H,1H2,(H,10,11)/t2-,3-,4-,5+/m1/s1 |
| InChIKey | RFMXGQTUCLOSLU-AIHAYLRMSA-N |
| XLogP | -1.97 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|