C6H13NNaO8P — CID 90476501
sodium [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate (PubChem CID 90476501) has the molecular formula C6H13NNaO8P and a molecular weight of 281.13 g/mol. Its IUPAC name is sodium [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate.
| Compound Name | sodium [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 90476501 |
| Molecular Formula | C6H13NNaO8P |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | sodium [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate |
| SMILES | N[C@H]1C(O)O[C@H](COP(=O)([O-])O)[C@@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C6H14NO8P.Na/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13;/h2-6,8-10H,1,7H2,(H2,11,12,13);/q;+1/p-1/t2-,3-,4-,5-,6?;/m1./s1 |
| InChIKey | ITFLGSDHWWAGKW-NSEZLWDYSA-M |
| XLogP | -6.77 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | -6.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|