C6H16NO9P — CID 71317090
[(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxy(2,3,4,5,6-13C5)oxan-2-yl](113C)methyl dihydrogen phosphate;hydrate (PubChem CID 71317090) has the molecular formula C6H16NO9P and a molecular weight of 283.12 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxy(2,3,4,5,6-13C5)oxan-2-yl](113C)methyl dihydrogen phosphate;hydrate.
| Compound Name | [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxy(2,3,4,5,6-13C5)oxan-2-yl](113C)methyl dihydrogen phosphate;hydrate |
|---|---|
| PubChem CID | 71317090 |
| Molecular Formula | C6H16NO9P |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxy(2,3,4,5,6-13C5)oxan-2-yl](113C)methyl dihydrogen phosphate;hydrate |
| SMILES | N[13C@H]1[13CH](O)O[13C@H]([13CH2]OP(=O)(O)O)[13C@@H](O)[13C@@H]1O.O |
| InChI | InChI=1S/C6H14NO8P.H2O/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13;/h2-6,8-10H,1,7H2,(H2,11,12,13);1H2/t2-,3-,4-,5-,6?;/m1./s1/i1+1,2+1,3+1,4+1,5+1,6+1; |
| InChIKey | WFVOZJAYZYVDTL-CBIGNMKJSA-N |
| XLogP | -3.96 |
| TPSA | 194.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|