C12H31NO29P6 — CID 11308901
(2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;(2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate (PubChem CID 11308901) has the molecular formula C12H31NO29P6 and a molecular weight of 839.20 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;(2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate.
| Compound Name | (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;(2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 11308901 |
| Molecular Formula | C12H31NO29P6 |
| Molecular Weight | 839.20 g/mol |
| Exact Mass | 838.94 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;(2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O.O=P(O)(O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
| InChI | InChI=1S/C6H13NO5.C6H18O24P6/c7-3-5(10)4(9)2(1-8)12-6(3)11;7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h2-6,8-11H,1,7H2;1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t2-,3-,4-,5-,6-;/m1./s1 |
| InChIKey | QJRFKPDROKMLIG-OCOFDJSDSA-N |
| XLogP | -6.39 |
| TPSA | 516.73 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.20 |
| LogP ≤ 5 | -6.39 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|