C6H14NO8P — CID 58860456
[(2S,3R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate (PubChem CID 58860456) has the molecular formula C6H14NO8P and a molecular weight of 259.15 g/mol. Its IUPAC name is [(2S,3R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate.
| Compound Name | [(2S,3R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58860456 |
| Molecular Formula | C6H14NO8P |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | [(2S,3R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
| SMILES | N[C@@H]1C(O)[C@@H](O)C(CO)O[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C6H14NO8P/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2?,3-,4+,5?,6+/m1/s1 |
| InChIKey | YMJBYRVFGYXULK-KYKSVUQTSA-N |
| XLogP | -3.14 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|