C8H16NO9P — CID 174982099
[(3S,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(phosphonooxymethyl)oxan-2-yl] acetate (PubChem CID 174982099) has the molecular formula C8H16NO9P and a molecular weight of 301.19 g/mol. Its IUPAC name is [(3S,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(phosphonooxymethyl)oxan-2-yl] acetate.
| Compound Name | [(3S,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(phosphonooxymethyl)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 174982099 |
| Molecular Formula | C8H16NO9P |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [(3S,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(phosphonooxymethyl)oxan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1N |
| InChI | InChI=1S/C8H16NO9P/c1-3(10)17-8-5(9)7(12)6(11)4(18-8)2-16-19(13,14)15/h4-8,11-12H,2,9H2,1H3,(H2,13,14,15)/t4-,5+,6-,7-,8?/m1/s1 |
| InChIKey | OBFLXRXVMXFKLA-ZTVVOAFPSA-N |
| XLogP | -2.57 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|