C8H15NO9S — CID 174920003
[(3R,4R,5R,6R)-3-amino-4,5-dihydroxy-6-(sulfooxymethyl)oxan-2-yl] acetate (PubChem CID 174920003) has the molecular formula C8H15NO9S and a molecular weight of 301.27 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-3-amino-4,5-dihydroxy-6-(sulfooxymethyl)oxan-2-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-3-amino-4,5-dihydroxy-6-(sulfooxymethyl)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 174920003 |
| Molecular Formula | C8H15NO9S |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | [(3R,4R,5R,6R)-3-amino-4,5-dihydroxy-6-(sulfooxymethyl)oxan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](COS(=O)(=O)O)[C@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C8H15NO9S/c1-3(10)17-8-5(9)7(12)6(11)4(18-8)2-16-19(13,14)15/h4-8,11-12H,2,9H2,1H3,(H,13,14,15)/t4-,5-,6+,7-,8?/m1/s1 |
| InChIKey | UXRNIPLDBPQYHR-KEWYIRBNSA-N |
| XLogP | -2.86 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|