C14H20O13S — CID 11102017
[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(sulfooxymethyl)oxan-3-yl] acetate (PubChem CID 11102017) has the molecular formula C14H20O13S and a molecular weight of 428.37 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(sulfooxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(sulfooxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11102017 |
| Molecular Formula | C14H20O13S |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(sulfooxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H20O13S/c1-6(15)23-11-10(5-22-28(19,20)21)27-14(26-9(4)18)13(25-8(3)17)12(11)24-7(2)16/h10-14H,5H2,1-4H3,(H,19,20,21)/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | FIWXCNOCYHHGNK-RKQHYHRCSA-N |
| XLogP | -1.11 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|