C26H38O21S2 — CID 139063557
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(methylsulfonyloxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(methylsulfonyloxymethyl)oxan-2-yl]oxyoxan-3-yl] acetate (PubChem CID 139063557) has the molecular formula C26H38O21S2 and a molecular weight of 750.70 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(methylsulfonyloxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(methylsulfonyloxymethyl)oxan-2-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(methylsulfonyloxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(methylsulfonyloxymethyl)oxan-2-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 139063557 |
| Molecular Formula | C26H38O21S2 |
| Molecular Weight | 750.70 g/mol |
| Exact Mass | 750.13 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(methylsulfonyloxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(methylsulfonyloxymethyl)oxan-2-yl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](O[C@H]2O[C@H](COS(C)(=O)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)O[C@H](COS(C)(=O)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H38O21S2/c1-11(27)39-19-17(9-37-48(7,33)34)45-25(23(43-15(5)31)21(19)41-13(3)29)47-26-24(44-16(6)32)22(42-14(4)30)20(40-12(2)28)18(46-26)10-38-49(8,35)36/h17-26H,9-10H2,1-8H3/t17-,18-,19-,20-,21+,22+,23-,24-,25-,26-/m1/s1 |
| InChIKey | HJXHXEKAOJTHIT-PCIRLDFKSA-N |
| XLogP | -2.00 |
| TPSA | 272.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.70 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|