C12H18O10S — CID 135014342
[4,5-diacetyloxy-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 135014342) has the molecular formula C12H18O10S and a molecular weight of 354.33 g/mol. Its IUPAC name is [4,5-diacetyloxy-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 135014342 |
| Molecular Formula | C12H18O10S |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | [4,5-diacetyloxy-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1OC(COS(C)(=O)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C12H18O10S/c1-6(13)19-10-9(5-18-23(4,16)17)22-12(21-8(3)15)11(10)20-7(2)14/h9-12H,5H2,1-4H3 |
| InChIKey | NYTDHQYAUPGMMY-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|