C18H22O10S — CID 18346191
[(2R,3R,4R)-4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate (PubChem CID 18346191) has the molecular formula C18H22O10S and a molecular weight of 430.43 g/mol. Its IUPAC name is [(2R,3R,4R)-4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R)-4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 18346191 |
| Molecular Formula | C18H22O10S |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [(2R,3R,4R)-4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H22O10S/c1-10-5-7-14(8-6-10)29(22,23)24-9-15-16(25-11(2)19)17(26-12(3)20)18(28-15)27-13(4)21/h5-8,15-18H,9H2,1-4H3/t15-,16-,17-,18?/m1/s1 |
| InChIKey | IXSKZROBIXERNP-NGHJQRJNSA-N |
| XLogP | 0.85 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|