C27H31NO11S — CID 98298103
[(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-[(4-methoxyphenyl)methylideneamino]-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 98298103) has the molecular formula C27H31NO11S and a molecular weight of 577.61 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-[(4-methoxyphenyl)methylideneamino]-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-[(4-methoxyphenyl)methylideneamino]-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 98298103 |
| Molecular Formula | C27H31NO11S |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-[(4-methoxyphenyl)methylideneamino]-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | COc1ccc(/C=N/[C@@H]2[C@@H](OC(C)=O)O[C@H](COS(=O)(=O)c3ccc(C)cc3)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C27H31NO11S/c1-16-6-12-22(13-7-16)40(32,33)35-15-23-25(36-17(2)29)26(37-18(3)30)24(27(39-23)38-19(4)31)28-14-20-8-10-21(34-5)11-9-20/h6-14,23-27H,15H2,1-5H3/b28-14+/t23-,24+,25+,26+,27+/m1/s1 |
| InChIKey | QVKXKFYRGRLVIN-CORMIBMKSA-N |
| XLogP | 2.35 |
| TPSA | 153.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|