C21H24INO9 — CID 58595002
[(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[(4-iodophenyl)methylideneamino]oxan-2-yl]methyl acetate (PubChem CID 58595002) has the molecular formula C21H24INO9 and a molecular weight of 561.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[(4-iodophenyl)methylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[(4-iodophenyl)methylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58595002 |
| Molecular Formula | C21H24INO9 |
| Molecular Weight | 561.33 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[(4-iodophenyl)methylideneamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](/N=C/c2ccc(I)cc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H24INO9/c1-11(24)28-10-17-19(29-12(2)25)20(30-13(3)26)18(21(32-17)31-14(4)27)23-9-15-5-7-16(22)8-6-15/h5-9,17-21H,10H2,1-4H3/b23-9+/t17-,18-,19-,20-,21?/m1/s1 |
| InChIKey | KFXAEVBWNBECMR-FKPYDFLRSA-N |
| XLogP | 1.79 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|