C21H25NO10 — CID 136867113
[(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-hydroxyphenyl)methylideneamino]oxan-2-yl]methyl acetate (PubChem CID 136867113) has the molecular formula C21H25NO10 and a molecular weight of 451.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-hydroxyphenyl)methylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-hydroxyphenyl)methylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 136867113 |
| Molecular Formula | C21H25NO10 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-hydroxyphenyl)methylideneamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](/N=C/c2ccccc2O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO10/c1-11(23)28-10-17-19(29-12(2)24)20(30-13(3)25)18(21(32-17)31-14(4)26)22-9-15-7-5-6-8-16(15)27/h5-9,17-21,27H,10H2,1-4H3/b22-9+/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | PFIXWQFUJUBYIX-FXKFZOFGSA-N |
| XLogP | 0.89 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|