C22H27NO10 — CID 45039720
[(3S,5S,6S)-3,4,6-triacetyloxy-5-[(4-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate (PubChem CID 45039720) has the molecular formula C22H27NO10 and a molecular weight of 465.46 g/mol. Its IUPAC name is [(3S,5S,6S)-3,4,6-triacetyloxy-5-[(4-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,5S,6S)-3,4,6-triacetyloxy-5-[(4-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45039720 |
| Molecular Formula | C22H27NO10 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [(3S,5S,6S)-3,4,6-triacetyloxy-5-[(4-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(/C=N/[C@H]2C(OC(C)=O)[C@H](OC(C)=O)C(COC(C)=O)O[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C22H27NO10/c1-12(24)29-11-18-20(30-13(2)25)21(31-14(3)26)19(22(33-18)32-15(4)27)23-10-16-6-8-17(28-5)9-7-16/h6-10,18-22H,11H2,1-5H3/b23-10+/t18?,19-,20+,21?,22+/m0/s1 |
| InChIKey | BPVDJXUNJWJXMH-MSXVSGGESA-N |
| XLogP | 1.20 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|