C20H25NO9 — CID 133112847
[4,6-diacetyloxy-2-(hydroxymethyl)-5-[(4-methoxyphenyl)methylideneamino]oxan-3-yl] acetate (PubChem CID 133112847) has the molecular formula C20H25NO9 and a molecular weight of 423.42 g/mol. Its IUPAC name is [4,6-diacetyloxy-2-(hydroxymethyl)-5-[(4-methoxyphenyl)methylideneamino]oxan-3-yl] acetate.
| Compound Name | [4,6-diacetyloxy-2-(hydroxymethyl)-5-[(4-methoxyphenyl)methylideneamino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 133112847 |
| Molecular Formula | C20H25NO9 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [4,6-diacetyloxy-2-(hydroxymethyl)-5-[(4-methoxyphenyl)methylideneamino]oxan-3-yl] acetate |
| SMILES | COc1ccc(/C=N/C2C(OC(C)=O)OC(CO)C(OC(C)=O)C2OC(C)=O)cc1 |
| InChI | InChI=1S/C20H25NO9/c1-11(23)27-18-16(10-22)30-20(29-13(3)25)17(19(18)28-12(2)24)21-9-14-5-7-15(26-4)8-6-14/h5-9,16-20,22H,10H2,1-4H3/b21-9+ |
| InChIKey | KQCQTBWPJHUDFV-ZVBGSRNCSA-N |
| XLogP | 0.63 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|