C24H29NO12 — CID 56690549
[3,4,6-triacetyloxy-5-[(4-acetyloxy-3-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate (PubChem CID 56690549) has the molecular formula C24H29NO12 and a molecular weight of 523.49 g/mol. Its IUPAC name is [3,4,6-triacetyloxy-5-[(4-acetyloxy-3-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,6-triacetyloxy-5-[(4-acetyloxy-3-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 56690549 |
| Molecular Formula | C24H29NO12 |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | [3,4,6-triacetyloxy-5-[(4-acetyloxy-3-methoxyphenyl)methylideneamino]oxan-2-yl]methyl acetate |
| SMILES | COc1cc(/C=N/C2C(OC(C)=O)OC(COC(C)=O)C(OC(C)=O)C2OC(C)=O)ccc1OC(C)=O |
| InChI | InChI=1S/C24H29NO12/c1-12(26)32-11-20-22(34-14(3)28)23(35-15(4)29)21(24(37-20)36-16(5)30)25-10-17-7-8-18(33-13(2)27)19(9-17)31-6/h7-10,20-24H,11H2,1-6H3/b25-10+ |
| InChIKey | SQYYDQXDUZOROK-KIBLKLHPSA-N |
| XLogP | 1.12 |
| TPSA | 162.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|