C26H32O12 — CID 102405972
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3,4-dimethoxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate (PubChem CID 102405972) has the molecular formula C26H32O12 and a molecular weight of 536.53 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3,4-dimethoxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3,4-dimethoxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102405972 |
| Molecular Formula | C26H32O12 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3,4-dimethoxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(/C=C/C(=O)C[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1OC |
| InChI | InChI=1S/C26H32O12/c1-14(27)34-13-23-25(36-16(3)29)26(37-17(4)30)24(35-15(2)28)22(38-23)12-19(31)9-7-18-8-10-20(32-5)21(11-18)33-6/h7-11,22-26H,12-13H2,1-6H3/b9-7+/t22-,23+,24-,25+,26+/m0/s1 |
| InChIKey | CQWULWJFLMNGEK-CVEQTENHSA-N |
| XLogP | 1.80 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|