C22H26O11 — CID 127029397
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate (PubChem CID 127029397) has the molecular formula C22H26O11 and a molecular weight of 466.44 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 127029397 |
| Molecular Formula | C22H26O11 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CC(=O)/C=C/c2ccco2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H26O11/c1-12(23)29-11-19-21(31-14(3)25)22(32-15(4)26)20(30-13(2)24)18(33-19)10-16(27)7-8-17-6-5-9-28-17/h5-9,18-22H,10-11H2,1-4H3/b8-7+/t18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | YLHGWMUSQKJEGE-PDEMRAINSA-N |
| XLogP | 1.38 |
| TPSA | 144.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|