C31H35NO12S — CID 118712464
[(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxobut-3-enyl]oxan-2-yl]methyl acetate (PubChem CID 118712464) has the molecular formula C31H35NO12S and a molecular weight of 645.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxobut-3-enyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118712464 |
| Molecular Formula | C31H35NO12S |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-[3-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CC(=O)/C=C/c2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H35NO12S/c1-18-9-13-26(14-10-18)45(38,39)32-24-8-6-7-23(15-24)11-12-25(37)16-27-29(41-20(3)34)31(43-22(5)36)30(42-21(4)35)28(44-27)17-40-19(2)33/h6-15,27-32H,16-17H2,1-5H3/b12-11+/t27-,28+,29+,30+,31+/m0/s1 |
| InChIKey | BJTIKIZWLLIOGY-QGPWZITCSA-N |
| XLogP | 2.89 |
| TPSA | 177.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|