C28H29N3O11S — CID 10793879
[(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[(E)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]oxan-2-yl]methyl acetate (PubChem CID 10793879) has the molecular formula C28H29N3O11S and a molecular weight of 615.62 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[(E)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[(E)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10793879 |
| Molecular Formula | C28H29N3O11S |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[(E)-[(4-methylphenyl)sulfonylhydrazinylidene]methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](/C=N/NS(=O)(=O)c2ccc(C)cc2)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H29N3O11S/c1-15-9-11-19(12-10-15)43(37,38)30-29-13-22-24(31-27(35)20-7-5-6-8-21(20)28(31)36)26(41-18(4)34)25(40-17(3)33)23(42-22)14-39-16(2)32/h5-13,22-26,30H,14H2,1-4H3/b29-13+/t22-,23+,24-,25+,26+/m0/s1 |
| InChIKey | BOSFFGSGROPYEJ-GJJIXWQFSA-N |
| XLogP | 1.12 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|