C26H31NO11 — CID 101220483
[(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 101220483) has the molecular formula C26H31NO11 and a molecular weight of 533.53 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101220483 |
| Molecular Formula | C26H31NO11 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C[C@@H]2COC(C)(C)O2)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H31NO11/c1-13(28)33-12-20-22(35-14(2)29)23(36-15(3)30)21(19(37-20)10-16-11-34-26(4,5)38-16)27-24(31)17-8-6-7-9-18(17)25(27)32/h6-9,16,19-23H,10-12H2,1-5H3/t16-,19+,20-,21+,22-,23-/m1/s1 |
| InChIKey | RTGAYXOZIQTCEA-ZCOQIOCDSA-N |
| XLogP | 1.39 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|