C21H20N2O9 — CID 101269036
[(2R,3S,4R,5S)-3,4-diacetyloxy-6-cyano-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 101269036) has the molecular formula C21H20N2O9 and a molecular weight of 444.40 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-diacetyloxy-6-cyano-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S)-3,4-diacetyloxy-6-cyano-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101269036 |
| Molecular Formula | C21H20N2O9 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-diacetyloxy-6-cyano-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(C#N)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H20N2O9/c1-10(24)29-9-16-18(30-11(2)25)19(31-12(3)26)17(15(8-22)32-16)23-20(27)13-6-4-5-7-14(13)21(23)28/h4-7,15-19H,9H2,1-3H3/t15?,16-,17+,18-,19-/m1/s1 |
| InChIKey | SJGFSLQHMXLNCL-BMSWRWNDSA-N |
| XLogP | 0.37 |
| TPSA | 149.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|