C33H39NO18 — CID 102182600
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 102182600) has the molecular formula C33H39NO18 and a molecular weight of 737.66 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102182600 |
| Molecular Formula | C33H39NO18 |
| Molecular Weight | 737.66 g/mol |
| Exact Mass | 737.22 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](CO[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2N2C(=O)c3ccccc3C2=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H39NO18/c1-14(35)44-12-22-25(46-15(2)36)27(48-17(4)38)24(34-30(41)20-10-8-9-11-21(20)31(34)42)32(51-22)45-13-23-26(47-16(3)37)28(49-18(5)39)29(50-19(6)40)33(43-7)52-23/h8-11,22-29,32-33H,12-13H2,1-7H3/t22-,23-,24-,25-,26-,27-,28+,29-,32-,33+/m1/s1 |
| InChIKey | FSXMNTFTYKSPLD-GUQRDQQYSA-N |
| XLogP | -0.01 |
| TPSA | 232.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.66 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|