C27H33NO15 — CID 10974110
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 10974110) has the molecular formula C27H33NO15 and a molecular weight of 611.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10974110 |
| Molecular Formula | C27H33NO15 |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](CO[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2N2C(=O)c3ccccc3C2=O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H33NO15/c1-11(29)38-10-17-22(40-12(2)30)23(41-13(3)31)18(28-24(35)14-7-5-6-8-15(14)25(28)36)26(43-17)39-9-16-19(32)20(33)21(34)27(37-4)42-16/h5-8,16-23,26-27,32-34H,9-10H2,1-4H3/t16-,17-,18-,19+,20+,21-,22-,23-,26-,27-/m1/s1 |
| InChIKey | UJPQTAOBFRJINJ-OCNNAMRTSA-N |
| XLogP | -1.73 |
| TPSA | 213.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|