C34H39NO19 — CID 102119740
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 102119740) has the molecular formula C34H39NO19 and a molecular weight of 765.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102119740 |
| Molecular Formula | C34H39NO19 |
| Molecular Weight | 765.67 g/mol |
| Exact Mass | 765.21 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(1,3-dioxoisoindol-2-yl)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC[C@H]2O[C@@H](OC(C)=O)[C@H](N3C(=O)c4ccccc4C3=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H39NO19/c1-14(36)45-12-23-27(48-16(3)38)29(50-18(5)40)30(51-19(6)41)34(54-23)46-13-24-26(47-15(2)37)28(49-17(4)39)25(33(53-24)52-20(7)42)35-31(43)21-10-8-9-11-22(21)32(35)44/h8-11,23-30,33-34H,12-13H2,1-7H3/t23-,24-,25-,26-,27-,28-,29+,30-,33-,34?/m1/s1 |
| InChIKey | XBKKBKZTASWLPE-NQRJYVLYSA-N |
| XLogP | -0.10 |
| TPSA | 249.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.67 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|