C24H27NO12 — CID 102405976
[(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3-nitrophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate (PubChem CID 102405976) has the molecular formula C24H27NO12 and a molecular weight of 521.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3-nitrophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3-nitrophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102405976 |
| Molecular Formula | C24H27NO12 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(3-nitrophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CC(=O)/C=C/c2cccc([N+](=O)[O-])c2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H27NO12/c1-13(26)33-12-21-23(35-15(3)28)24(36-16(4)29)22(34-14(2)27)20(37-21)11-19(30)9-8-17-6-5-7-18(10-17)25(31)32/h5-10,20-24H,11-12H2,1-4H3/b9-8+/t20-,21+,22+,23+,24+/m0/s1 |
| InChIKey | RHTGOPKTUAGTTA-OIYCGUTESA-N |
| XLogP | 1.69 |
| TPSA | 174.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|