C21H23F2NO12 — CID 130452325
[3,4,5-triacetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]oxan-2-yl]methyl acetate (PubChem CID 130452325) has the molecular formula C21H23F2NO12 and a molecular weight of 519.41 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 130452325 |
| Molecular Formula | C21H23F2NO12 |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc([N+](=O)[O-])cc2C(F)F)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H23F2NO12/c1-9(25)31-8-16-17(32-10(2)26)18(33-11(3)27)19(34-12(4)28)21(36-16)35-15-6-5-13(24(29)30)7-14(15)20(22)23/h5-7,16-21H,8H2,1-4H3 |
| InChIKey | UOFVEOUGVFKYLD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 166.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|