C19H23F2NO8 — CID 161366837
[(3R,4S,6S)-5-acetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 161366837) has the molecular formula C19H23F2NO8 and a molecular weight of 431.39 g/mol. Its IUPAC name is [(3R,4S,6S)-5-acetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-5-acetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 161366837 |
| Molecular Formula | C19H23F2NO8 |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [(3R,4S,6S)-5-acetyloxy-6-[2-(difluoromethyl)-4-nitrophenoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Oc2ccc([N+](=O)[O-])cc2C(F)F)C(OC(C)=O)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C19H23F2NO8/c1-9-10(2)17(28-12(4)24)19(30-16(9)8-27-11(3)23)29-15-6-5-13(22(25)26)7-14(15)18(20)21/h5-7,9-10,16-19H,8H2,1-4H3/t9-,10+,16?,17?,19-/m1/s1 |
| InChIKey | QKINISSSFQNKOG-ZLCBNBAISA-N |
| XLogP | 3.40 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|